C20H21F2N3O — CID 143331168
4-fluoro-N'-[[1-[(4-fluorophenyl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methoxy]benzenecarboximidamide (PubChem CID 143331168) has the molecular formula C20H21F2N3O and a molecular weight of 357.40 g/mol. Its IUPAC name is 4-fluoro-N'-[[1-[(4-fluorophenyl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methoxy]benzenecarboximidamide.
| Compound Name | 4-fluoro-N'-[[1-[(4-fluorophenyl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 143331168 |
| Molecular Formula | C20H21F2N3O |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-fluoro-N'-[[1-[(4-fluorophenyl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methoxy]benzenecarboximidamide |
| SMILES | N/C(=N\OCC1=CCCN(Cc2ccc(F)cc2)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21F2N3O/c21-18-7-3-15(4-8-18)12-25-11-1-2-16(13-25)14-26-24-20(23)17-5-9-19(22)10-6-17/h2-10H,1,11-14H2,(H2,23,24) |
| InChIKey | UBUSZFZCBWCILW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|