C22H36N2O2S — CID 4313386
3-methyl-1-[3-(4-methylphenyl)sulfonyl-2-(3-methylpiperidin-1-yl)propyl]piperidine (PubChem CID 4313386) has the molecular formula C22H36N2O2S and a molecular weight of 392.61 g/mol. Its IUPAC name is 3-methyl-1-[3-(4-methylphenyl)sulfonyl-2-(3-methylpiperidin-1-yl)propyl]piperidine.
| Compound Name | 3-methyl-1-[3-(4-methylphenyl)sulfonyl-2-(3-methylpiperidin-1-yl)propyl]piperidine |
|---|---|
| PubChem CID | 4313386 |
| Molecular Formula | C22H36N2O2S |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 3-methyl-1-[3-(4-methylphenyl)sulfonyl-2-(3-methylpiperidin-1-yl)propyl]piperidine |
| SMILES | Cc1ccc(S(=O)(=O)CC(CN2CCCC(C)C2)N2CCCC(C)C2)cc1 |
| InChI | InChI=1S/C22H36N2O2S/c1-18-8-10-22(11-9-18)27(25,26)17-21(24-13-5-7-20(3)15-24)16-23-12-4-6-19(2)14-23/h8-11,19-21H,4-7,12-17H2,1-3H3 |
| InChIKey | FXDNNCFKUREDQO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |