C18H25N3O3 — CID 4313519
N-[1-(cyclopentylcarbamoyl)cyclohexyl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 4313519) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[1-(cyclopentylcarbamoyl)cyclohexyl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[1-(cyclopentylcarbamoyl)cyclohexyl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4313519 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[1-(cyclopentylcarbamoyl)cyclohexyl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC1(C(=O)NC2CCCC2)CCCCC1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C18H25N3O3/c22-15-9-8-13(12-19-15)16(23)21-18(10-4-1-5-11-18)17(24)20-14-6-2-3-7-14/h8-9,12,14H,1-7,10-11H2,(H,19,22)(H,20,24)(H,21,23) |
| InChIKey | HKLPDLOIZZEACR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |