C10H14F2N2O2S — CID 43135974
N-(3-aminopropyl)-1,1-difluoro-N-phenylmethanesulfonamide (PubChem CID 43135974) has the molecular formula C10H14F2N2O2S and a molecular weight of 264.30 g/mol. Its IUPAC name is N-(3-aminopropyl)-1,1-difluoro-N-phenylmethanesulfonamide.
| Compound Name | N-(3-aminopropyl)-1,1-difluoro-N-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 43135974 |
| Molecular Formula | C10H14F2N2O2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-(3-aminopropyl)-1,1-difluoro-N-phenylmethanesulfonamide |
| SMILES | NCCCN(c1ccccc1)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C10H14F2N2O2S/c11-10(12)17(15,16)14(8-4-7-13)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8,13H2 |
| InChIKey | HDCZPEGEBAQMBY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |