C13H22FN3O2S — CID 114813771
1-[3-aminopropyl(2-methylpropylsulfamoyl)amino]-4-fluorobenzene (PubChem CID 114813771) has the molecular formula C13H22FN3O2S and a molecular weight of 303.40 g/mol. Its IUPAC name is 1-[3-aminopropyl(2-methylpropylsulfamoyl)amino]-4-fluorobenzene.
| Compound Name | 1-[3-aminopropyl(2-methylpropylsulfamoyl)amino]-4-fluorobenzene |
|---|---|
| PubChem CID | 114813771 |
| Molecular Formula | C13H22FN3O2S |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-[3-aminopropyl(2-methylpropylsulfamoyl)amino]-4-fluorobenzene |
| SMILES | CC(C)CNS(=O)(=O)N(CCCN)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H22FN3O2S/c1-11(2)10-16-20(18,19)17(9-3-8-15)13-6-4-12(14)5-7-13/h4-7,11,16H,3,8-10,15H2,1-2H3 |
| InChIKey | VDXDPXWIDVOLSG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |