C25H36F2N2O4S2 — CID 90121629
N,N'-bis(4-fluorophenyl)-N,N'-dihexylmethanedisulfonamide (PubChem CID 90121629) has the molecular formula C25H36F2N2O4S2 and a molecular weight of 530.70 g/mol. Its IUPAC name is N,N'-bis(4-fluorophenyl)-N,N'-dihexylmethanedisulfonamide.
| Compound Name | N,N'-bis(4-fluorophenyl)-N,N'-dihexylmethanedisulfonamide |
|---|---|
| PubChem CID | 90121629 |
| Molecular Formula | C25H36F2N2O4S2 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N,N'-bis(4-fluorophenyl)-N,N'-dihexylmethanedisulfonamide |
| SMILES | CCCCCCN(c1ccc(F)cc1)S(=O)(=O)CS(=O)(=O)N(CCCCCC)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H36F2N2O4S2/c1-3-5-7-9-19-28(24-15-11-22(26)12-16-24)34(30,31)21-35(32,33)29(20-10-8-6-4-2)25-17-13-23(27)14-18-25/h11-18H,3-10,19-21H2,1-2H3 |
| InChIKey | RZUFNCUBTBSLLO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|