About N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine
N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine (PubChem CID 43136242) has the molecular formula C14H16FN3
and a molecular weight of 245.30 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine |
| PubChem CID | 43136242 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine |
| SMILES | NCCCN(c1ccncc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FN3/c15-12-2-4-13(5-3-12)18(11-1-8-16)14-6-9-17-10-7-14/h2-7,9-10H,1,8,11,16H2 |
| InChIKey | KFBGUGMHZRUQIF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine?
The IUPAC name of N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine (CID 43136242) is N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine.
What is the SMILES notation for N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine?
The canonical SMILES for N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine is NCCCN(c1ccncc1)c1ccc(F)cc1.
What is the InChIKey of N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine?
The InChIKey is KFBGUGMHZRUQIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FN3/c15-12-2-4-13(5-3-12)18(11-1-8-16)14-6-9-17-10-7-14/h2-7,9-10H,1,8,11,16H2.
What are the key properties of N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine?
N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine has a molecular weight of 245.30 g/mol, XLogP of 2.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-fluorophenyl)-N'-pyridin-4-ylpropane-1,3-diamine is sourced from PubChem (CID 43136242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).