C10H11F3N2O2 — CID 43138698
4-(2-hydroxyethoxy)-2-(trifluoromethyl)benzenecarboximidamide (PubChem CID 43138698) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 4-(2-hydroxyethoxy)-2-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 4-(2-hydroxyethoxy)-2-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 43138698 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-(2-hydroxyethoxy)-2-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCO)cc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O2/c11-10(12,13)8-5-6(17-4-3-16)1-2-7(8)9(14)15/h1-2,5,16H,3-4H2,(H3,14,15) |
| InChIKey | KAGFYEYSJIHRFY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 79.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|