C9H10F3N3 — CID 62200669
4-(methylamino)-2-(trifluoromethyl)benzenecarboximidamide (PubChem CID 62200669) has the molecular formula C9H10F3N3 and a molecular weight of 217.19 g/mol. Its IUPAC name is 4-(methylamino)-2-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 4-(methylamino)-2-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 62200669 |
| Molecular Formula | C9H10F3N3 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 4-(methylamino)-2-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC)cc1C(F)(F)F |
| InChI | InChI=1S/C9H10F3N3/c1-15-5-2-3-6(8(13)14)7(4-5)9(10,11)12/h2-4,15H,1H3,(H3,13,14) |
| InChIKey | KLBIKGSXHBLUNY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|