C12H16F3N3O2S — CID 65483393
4-(2-methylpropylsulfonylamino)-2-(trifluoromethyl)benzenecarboximidamide (PubChem CID 65483393) has the molecular formula C12H16F3N3O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is 4-(2-methylpropylsulfonylamino)-2-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 4-(2-methylpropylsulfonylamino)-2-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 65483393 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-(2-methylpropylsulfonylamino)-2-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NS(=O)(=O)CC(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O2S/c1-7(2)6-21(19,20)18-8-3-4-9(11(16)17)10(5-8)12(13,14)15/h3-5,7,18H,6H2,1-2H3,(H3,16,17) |
| InChIKey | NVYHMOOVIMFFIM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|