C12H15F3N4O — CID 79162710
3-[4-carbamimidoyl-3-(trifluoromethyl)phenyl]-1-ethyl-1-methylurea (PubChem CID 79162710) has the molecular formula C12H15F3N4O and a molecular weight of 288.27 g/mol. Its IUPAC name is 3-[4-carbamimidoyl-3-(trifluoromethyl)phenyl]-1-ethyl-1-methylurea.
| Compound Name | 3-[4-carbamimidoyl-3-(trifluoromethyl)phenyl]-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 79162710 |
| Molecular Formula | C12H15F3N4O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-[4-carbamimidoyl-3-(trifluoromethyl)phenyl]-1-ethyl-1-methylurea |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)N(C)CC)cc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N4O/c1-3-19(2)11(20)18-7-4-5-8(10(16)17)9(6-7)12(13,14)15/h4-6H,3H2,1-2H3,(H3,16,17)(H,18,20) |
| InChIKey | AUGZJHIVBNGHBY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|