C12H11F3N4 — CID 62488493
4-(3-methylpyrazol-1-yl)-2-(trifluoromethyl)benzenecarboximidamide (PubChem CID 62488493) has the molecular formula C12H11F3N4 and a molecular weight of 268.24 g/mol. Its IUPAC name is 4-(3-methylpyrazol-1-yl)-2-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 4-(3-methylpyrazol-1-yl)-2-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 62488493 |
| Molecular Formula | C12H11F3N4 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-(3-methylpyrazol-1-yl)-2-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-n2ccc(C)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H11F3N4/c1-7-4-5-19(18-7)8-2-3-9(11(16)17)10(6-8)12(13,14)15/h2-6H,1H3,(H3,16,17) |
| InChIKey | OOQOQILYUUNUFD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|