C11H11ClN4 — CID 43142805
5-chloro-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)aniline (PubChem CID 43142805) has the molecular formula C11H11ClN4 and a molecular weight of 234.69 g/mol. Its IUPAC name is 5-chloro-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)aniline.
| Compound Name | 5-chloro-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)aniline |
|---|---|
| PubChem CID | 43142805 |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 5-chloro-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)aniline |
| SMILES | Nc1cc(Cl)ccc1-c1nnc2n1CCC2 |
| InChI | InChI=1S/C11H11ClN4/c12-7-3-4-8(9(13)6-7)11-15-14-10-2-1-5-16(10)11/h3-4,6H,1-2,5,13H2 |
| InChIKey | QMHIMVYGYCEGLC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|