C12H13IN4 — CID 81056962
4-iodo-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline (PubChem CID 81056962) has the molecular formula C12H13IN4 and a molecular weight of 340.17 g/mol. Its IUPAC name is 4-iodo-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline.
| Compound Name | 4-iodo-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline |
|---|---|
| PubChem CID | 81056962 |
| Molecular Formula | C12H13IN4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 4-iodo-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline |
| SMILES | Nc1ccc(I)cc1-c1nnc2n1CCCC2 |
| InChI | InChI=1S/C12H13IN4/c13-8-4-5-10(14)9(7-8)12-16-15-11-3-1-2-6-17(11)12/h4-5,7H,1-3,6,14H2 |
| InChIKey | GTFFFLAFSUPYNO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|