C9H9BrN2O2 — CID 43143915
5-bromo-2,3-dihydro-1,4-benzodioxine-7-carboximidamide (PubChem CID 43143915) has the molecular formula C9H9BrN2O2 and a molecular weight of 257.09 g/mol. Its IUPAC name is 5-bromo-2,3-dihydro-1,4-benzodioxine-7-carboximidamide.
| Compound Name | 5-bromo-2,3-dihydro-1,4-benzodioxine-7-carboximidamide |
|---|---|
| PubChem CID | 43143915 |
| Molecular Formula | C9H9BrN2O2 |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 5-bromo-2,3-dihydro-1,4-benzodioxine-7-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Br)c2c(c1)OCCO2 |
| InChI | InChI=1S/C9H9BrN2O2/c10-6-3-5(9(11)12)4-7-8(6)14-2-1-13-7/h3-4H,1-2H2,(H3,11,12) |
| InChIKey | PSMQLYOKDAJUMK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|