C13H13N3O — CID 43144039
2-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]acetonitrile (PubChem CID 43144039) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]acetonitrile.
| Compound Name | 2-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]acetonitrile |
|---|---|
| PubChem CID | 43144039 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]acetonitrile |
| SMILES | Cn1ccnc1COc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C13H13N3O/c1-16-9-8-15-13(16)10-17-12-4-2-11(3-5-12)6-7-14/h2-5,8-9H,6,10H2,1H3 |
| InChIKey | ISBPXQDDLAYELB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |