C16H20N4O — CID 63015364
2-[4-[2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]ethoxy]phenyl]acetonitrile (PubChem CID 63015364) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[4-[2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]ethoxy]phenyl]acetonitrile.
| Compound Name | 2-[4-[2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]ethoxy]phenyl]acetonitrile |
|---|---|
| PubChem CID | 63015364 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-[4-[2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]ethoxy]phenyl]acetonitrile |
| SMILES | CN(CCOc1ccc(CC#N)cc1)Cc1nccn1C |
| InChI | InChI=1S/C16H20N4O/c1-19(13-16-18-9-10-20(16)2)11-12-21-15-5-3-14(4-6-15)7-8-17/h3-6,9-10H,7,11-13H2,1-2H3 |
| InChIKey | ZCZNXEDKZHFSQH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |