C11H6ClIN4 — CID 43144463
7-chloro-3-(3-iodophenyl)-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 43144463) has the molecular formula C11H6ClIN4 and a molecular weight of 356.55 g/mol. Its IUPAC name is 7-chloro-3-(3-iodophenyl)-[1,2,4]triazolo[4,3-c]pyrimidine.
| Compound Name | 7-chloro-3-(3-iodophenyl)-[1,2,4]triazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 43144463 |
| Molecular Formula | C11H6ClIN4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | 7-chloro-3-(3-iodophenyl)-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | Clc1cc2nnc(-c3cccc(I)c3)n2cn1 |
| InChI | InChI=1S/C11H6ClIN4/c12-9-5-10-15-16-11(17(10)6-14-9)7-2-1-3-8(13)4-7/h1-6H |
| InChIKey | SNVAYKLLQBNSIM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|