C17H13N5 — CID 82167018
3-(7-phenyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)aniline (PubChem CID 82167018) has the molecular formula C17H13N5 and a molecular weight of 287.33 g/mol. Its IUPAC name is 3-(7-phenyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)aniline.
| Compound Name | 3-(7-phenyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)aniline |
|---|---|
| PubChem CID | 82167018 |
| Molecular Formula | C17H13N5 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-(7-phenyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)aniline |
| SMILES | Nc1cccc(-c2nnc3cc(-c4ccccc4)ncn23)c1 |
| InChI | InChI=1S/C17H13N5/c18-14-8-4-7-13(9-14)17-21-20-16-10-15(19-11-22(16)17)12-5-2-1-3-6-12/h1-11H,18H2 |
| InChIKey | MNAYSNPCXGHAOV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|