C13H12N4 — CID 82058636
3-(8-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline (PubChem CID 82058636) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is 3-(8-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline.
| Compound Name | 3-(8-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline |
|---|---|
| PubChem CID | 82058636 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3-(8-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline |
| SMILES | Cc1cccn2c(-c3cccc(N)c3)nnc12 |
| InChI | InChI=1S/C13H12N4/c1-9-4-3-7-17-12(9)15-16-13(17)10-5-2-6-11(14)8-10/h2-8H,14H2,1H3 |
| InChIKey | JXCMYSVCQVDWOZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|