C12H13N3O2S — CID 43148552
2-[[4-(1-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 43148552) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-[[4-(1-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[4-(1-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 43148552 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-[[4-(1-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | CC(c1ccccc1)n1cnnc1SCC(=O)O |
| InChI | InChI=1S/C12H13N3O2S/c1-9(10-5-3-2-4-6-10)15-8-13-14-12(15)18-7-11(16)17/h2-6,8-9H,7H2,1H3,(H,16,17) |
| InChIKey | QYOZPCJEHFRFJI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |