C14H17N3O2S — CID 62986994
2-[[4-(3-phenylbutyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 62986994) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-[[4-(3-phenylbutyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[4-(3-phenylbutyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 62986994 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-[[4-(3-phenylbutyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | CC(CCn1cnnc1SCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H17N3O2S/c1-11(12-5-3-2-4-6-12)7-8-17-10-15-16-14(17)20-9-13(18)19/h2-6,10-11H,7-9H2,1H3,(H,18,19) |
| InChIKey | LYAWSRWNGLRJEN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |