C16H20N2O2S — CID 81344281
2-[4-methyl-1-(3-phenylbutyl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 81344281) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-[4-methyl-1-(3-phenylbutyl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-methyl-1-(3-phenylbutyl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81344281 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[4-methyl-1-(3-phenylbutyl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | Cc1cn(CCC(C)c2ccccc2)c(SCC(=O)O)n1 |
| InChI | InChI=1S/C16H20N2O2S/c1-12(14-6-4-3-5-7-14)8-9-18-10-13(2)17-16(18)21-11-15(19)20/h3-7,10,12H,8-9,11H2,1-2H3,(H,19,20) |
| InChIKey | SYZKKVLYDRDFOM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |