C15H23N3 — CID 43152020
3-(1-tert-butylbenzimidazol-2-yl)-N-methylpropan-1-amine (PubChem CID 43152020) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-(1-tert-butylbenzimidazol-2-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(1-tert-butylbenzimidazol-2-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 43152020 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 3-(1-tert-butylbenzimidazol-2-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCc1nc2ccccc2n1C(C)(C)C |
| InChI | InChI=1S/C15H23N3/c1-15(2,3)18-13-9-6-5-8-12(13)17-14(18)10-7-11-16-4/h5-6,8-9,16H,7,10-11H2,1-4H3 |
| InChIKey | UUVHLZSYXOJIQL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|