C9H5BrN2O3 — CID 43153907
1-(2-bromophenyl)imidazolidine-2,4,5-trione (PubChem CID 43153907) has the molecular formula C9H5BrN2O3 and a molecular weight of 269.05 g/mol. Its IUPAC name is 1-(2-bromophenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(2-bromophenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 43153907 |
| Molecular Formula | C9H5BrN2O3 |
| Molecular Weight | 269.05 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | 1-(2-bromophenyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1NC(=O)N(c2ccccc2Br)C1=O |
| InChI | InChI=1S/C9H5BrN2O3/c10-5-3-1-2-4-6(5)12-8(14)7(13)11-9(12)15/h1-4H,(H,11,13,15) |
| InChIKey | SRSBLLQVFQEICI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.05 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|