C9H4BrFN2O3 — CID 43153915
1-(2-bromo-4-fluorophenyl)imidazolidine-2,4,5-trione (PubChem CID 43153915) has the molecular formula C9H4BrFN2O3 and a molecular weight of 287.04 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(2-bromo-4-fluorophenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 43153915 |
| Molecular Formula | C9H4BrFN2O3 |
| Molecular Weight | 287.04 g/mol |
| Exact Mass | 285.94 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1NC(=O)N(c2ccc(F)cc2Br)C1=O |
| InChI | InChI=1S/C9H4BrFN2O3/c10-5-3-4(11)1-2-6(5)13-8(15)7(14)12-9(13)16/h1-3H,(H,12,14,16) |
| InChIKey | PGQZSTVQQOSBLZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.04 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|