C16H11BrFNO2 — CID 107640958
2-(2-bromo-5-fluorophenyl)-4,7-dimethylisoindole-1,3-dione (PubChem CID 107640958) has the molecular formula C16H11BrFNO2 and a molecular weight of 348.17 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-4,7-dimethylisoindole-1,3-dione.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-4,7-dimethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 107640958 |
| Molecular Formula | C16H11BrFNO2 |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-4,7-dimethylisoindole-1,3-dione |
| SMILES | Cc1ccc(C)c2c1C(=O)N(c1cc(F)ccc1Br)C2=O |
| InChI | InChI=1S/C16H11BrFNO2/c1-8-3-4-9(2)14-13(8)15(20)19(16(14)21)12-7-10(18)5-6-11(12)17/h3-7H,1-2H3 |
| InChIKey | SKHMNCDCOGEIME-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|