C25H18FN3O5 — CID 4315500
5-[[3-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid (PubChem CID 4315500) has the molecular formula C25H18FN3O5 and a molecular weight of 459.43 g/mol. Its IUPAC name is 5-[[3-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[3-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 4315500 |
| Molecular Formula | C25H18FN3O5 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 5-[[3-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cn2cc(C=C3NC(=O)N(Cc4ccccc4F)C3=O)c3ccccc32)o1 |
| InChI | InChI=1S/C25H18FN3O5/c26-19-7-3-1-5-15(19)13-29-23(30)20(27-25(29)33)11-16-12-28(21-8-4-2-6-18(16)21)14-17-9-10-22(34-17)24(31)32/h1-12H,13-14H2,(H,27,33)(H,31,32) |
| InChIKey | FBMFBAUSPPBZHQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|