C9H4ClF2N — CID 43155462
(Z)-3-chloro-3-(2,6-difluorophenyl)prop-2-enenitrile (PubChem CID 43155462) has the molecular formula C9H4ClF2N and a molecular weight of 199.59 g/mol. Its IUPAC name is (Z)-3-chloro-3-(2,6-difluorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-chloro-3-(2,6-difluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 43155462 |
| Molecular Formula | C9H4ClF2N |
| Molecular Weight | 199.59 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | (Z)-3-chloro-3-(2,6-difluorophenyl)prop-2-enenitrile |
| SMILES | N#C/C=C(\Cl)c1c(F)cccc1F |
| InChI | InChI=1S/C9H4ClF2N/c10-6(4-5-13)9-7(11)2-1-3-8(9)12/h1-4H/b6-4- |
| InChIKey | IQSCRNUFIXYRCQ-XQRVVYSFSA-N |
| XLogP | 3.07 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|