C11H10ClNO2 — CID 43155465
(Z)-3-chloro-3-(2,6-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 43155465) has the molecular formula C11H10ClNO2 and a molecular weight of 223.66 g/mol. Its IUPAC name is (Z)-3-chloro-3-(2,6-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-chloro-3-(2,6-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 43155465 |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | (Z)-3-chloro-3-(2,6-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cccc(OC)c1/C(Cl)=C/C#N |
| InChI | InChI=1S/C11H10ClNO2/c1-14-9-4-3-5-10(15-2)11(9)8(12)6-7-13/h3-6H,1-2H3/b8-6- |
| InChIKey | JYTUFPZQQBDZRQ-VURMDHGXSA-N |
| XLogP | 2.81 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|