C10H7Cl2N — CID 166114555
(E)-3-(2,6-dichlorophenyl)but-2-enenitrile (PubChem CID 166114555) has the molecular formula C10H7Cl2N and a molecular weight of 212.08 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)but-2-enenitrile.
| Compound Name | (E)-3-(2,6-dichlorophenyl)but-2-enenitrile |
|---|---|
| PubChem CID | 166114555 |
| Molecular Formula | C10H7Cl2N |
| Molecular Weight | 212.08 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)but-2-enenitrile |
| SMILES | C/C(=C\C#N)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H7Cl2N/c1-7(5-6-13)10-8(11)3-2-4-9(10)12/h2-5H,1H3/b7-5+ |
| InChIKey | FUVJKIASTJBESQ-FNORWQNLSA-N |
| XLogP | 3.92 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.08 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|