C11H10Cl2N4 — CID 163705815
2-[1-cyano-1-(2,6-dichlorophenyl)prop-1-en-2-yl]guanidine (PubChem CID 163705815) has the molecular formula C11H10Cl2N4 and a molecular weight of 269.14 g/mol. Its IUPAC name is 2-[1-cyano-1-(2,6-dichlorophenyl)prop-1-en-2-yl]guanidine.
| Compound Name | 2-[1-cyano-1-(2,6-dichlorophenyl)prop-1-en-2-yl]guanidine |
|---|---|
| PubChem CID | 163705815 |
| Molecular Formula | C11H10Cl2N4 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-[1-cyano-1-(2,6-dichlorophenyl)prop-1-en-2-yl]guanidine |
| SMILES | CC(N=C(N)N)=C(C#N)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H10Cl2N4/c1-6(17-11(15)16)7(5-14)10-8(12)3-2-4-9(10)13/h2-4H,1H3,(H4,15,16,17) |
| InChIKey | KEZKVQUELRWWGY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|