C15H10ClFN4O2 — CID 146508033
2-(3-chloro-2-fluorophenyl)-3-cyano-N-(diaminomethylidene)-6-hydroxybenzamide (PubChem CID 146508033) has the molecular formula C15H10ClFN4O2 and a molecular weight of 332.72 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-3-cyano-N-(diaminomethylidene)-6-hydroxybenzamide.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-3-cyano-N-(diaminomethylidene)-6-hydroxybenzamide |
|---|---|
| PubChem CID | 146508033 |
| Molecular Formula | C15H10ClFN4O2 |
| Molecular Weight | 332.72 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-3-cyano-N-(diaminomethylidene)-6-hydroxybenzamide |
| SMILES | N#Cc1ccc(O)c(C(=O)N=C(N)N)c1-c1cccc(Cl)c1F |
| InChI | InChI=1S/C15H10ClFN4O2/c16-9-3-1-2-8(13(9)17)11-7(6-18)4-5-10(22)12(11)14(23)21-15(19)20/h1-5,22H,(H4,19,20,21,23) |
| InChIKey | RUUZGMMXWNOCRO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.72 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|