C16H9ClFN5O2 — CID 146508128
2-(2-chloro-3-fluorophenyl)-3-cyano-N-(N'-cyanocarbamimidoyl)-6-hydroxybenzamide (PubChem CID 146508128) has the molecular formula C16H9ClFN5O2 and a molecular weight of 357.73 g/mol. Its IUPAC name is 2-(2-chloro-3-fluorophenyl)-3-cyano-N-(N'-cyanocarbamimidoyl)-6-hydroxybenzamide.
| Compound Name | 2-(2-chloro-3-fluorophenyl)-3-cyano-N-(N'-cyanocarbamimidoyl)-6-hydroxybenzamide |
|---|---|
| PubChem CID | 146508128 |
| Molecular Formula | C16H9ClFN5O2 |
| Molecular Weight | 357.73 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-(2-chloro-3-fluorophenyl)-3-cyano-N-(N'-cyanocarbamimidoyl)-6-hydroxybenzamide |
| SMILES | N#C/N=C(\N)NC(=O)c1c(O)ccc(C#N)c1-c1cccc(F)c1Cl |
| InChI | InChI=1S/C16H9ClFN5O2/c17-14-9(2-1-3-10(14)18)12-8(6-19)4-5-11(24)13(12)15(25)23-16(21)22-7-20/h1-5,24H,(H3,21,22,23,25) |
| InChIKey | MKTJZLUHXFJHMD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.73 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|