C20H24FN3O3 — CID 146508072
2-(3-fluoro-2-methylphenyl)-6-hydroxy-N-[N'-(2-hydroxy-2-methylpropyl)carbamimidoyl]-3-methylbenzamide (PubChem CID 146508072) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-(3-fluoro-2-methylphenyl)-6-hydroxy-N-[N'-(2-hydroxy-2-methylpropyl)carbamimidoyl]-3-methylbenzamide.
| Compound Name | 2-(3-fluoro-2-methylphenyl)-6-hydroxy-N-[N'-(2-hydroxy-2-methylpropyl)carbamimidoyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 146508072 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-(3-fluoro-2-methylphenyl)-6-hydroxy-N-[N'-(2-hydroxy-2-methylpropyl)carbamimidoyl]-3-methylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)N/C(N)=N/CC(C)(C)O)c1-c1cccc(F)c1C |
| InChI | InChI=1S/C20H24FN3O3/c1-11-8-9-15(25)17(16(11)13-6-5-7-14(21)12(13)2)18(26)24-19(22)23-10-20(3,4)27/h5-9,25,27H,10H2,1-4H3,(H3,22,23,24,26) |
| InChIKey | DWNICAGRMILHMD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|