C10H10N4O2 — CID 146508171
3-cyano-N-(diaminomethylidene)-6-hydroxy-2-methylbenzamide (PubChem CID 146508171) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 3-cyano-N-(diaminomethylidene)-6-hydroxy-2-methylbenzamide.
| Compound Name | 3-cyano-N-(diaminomethylidene)-6-hydroxy-2-methylbenzamide |
|---|---|
| PubChem CID | 146508171 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 3-cyano-N-(diaminomethylidene)-6-hydroxy-2-methylbenzamide |
| SMILES | Cc1c(C#N)ccc(O)c1C(=O)N=C(N)N |
| InChI | InChI=1S/C10H10N4O2/c1-5-6(4-11)2-3-7(15)8(5)9(16)14-10(12)13/h2-3,15H,1H3,(H4,12,13,14,16) |
| InChIKey | YSJRFRGYVWIPHK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|