C15H11FN4O3 — CID 146507998
3-cyano-N-(diaminomethylidene)-2-(3-fluorophenoxy)-6-hydroxybenzamide (PubChem CID 146507998) has the molecular formula C15H11FN4O3 and a molecular weight of 314.28 g/mol. Its IUPAC name is 3-cyano-N-(diaminomethylidene)-2-(3-fluorophenoxy)-6-hydroxybenzamide.
| Compound Name | 3-cyano-N-(diaminomethylidene)-2-(3-fluorophenoxy)-6-hydroxybenzamide |
|---|---|
| PubChem CID | 146507998 |
| Molecular Formula | C15H11FN4O3 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3-cyano-N-(diaminomethylidene)-2-(3-fluorophenoxy)-6-hydroxybenzamide |
| SMILES | N#Cc1ccc(O)c(C(=O)N=C(N)N)c1Oc1cccc(F)c1 |
| InChI | InChI=1S/C15H11FN4O3/c16-9-2-1-3-10(6-9)23-13-8(7-17)4-5-11(21)12(13)14(22)20-15(18)19/h1-6,21H,(H4,18,19,20,22) |
| InChIKey | XFQAGSUSXLFECY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 134.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|