C15H9N3O2 — CID 86818071
3-(2,6-dicyanophenoxy)benzamide (PubChem CID 86818071) has the molecular formula C15H9N3O2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 3-(2,6-dicyanophenoxy)benzamide.
| Compound Name | 3-(2,6-dicyanophenoxy)benzamide |
|---|---|
| PubChem CID | 86818071 |
| Molecular Formula | C15H9N3O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-(2,6-dicyanophenoxy)benzamide |
| SMILES | N#Cc1cccc(C#N)c1Oc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C15H9N3O2/c16-8-11-4-1-5-12(9-17)14(11)20-13-6-2-3-10(7-13)15(18)19/h1-7H,(H2,18,19) |
| InChIKey | KINQBBDCAZATLX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |