C21H14N4O2 — CID 2805877
1-[4-(2,6-dicyanophenoxy)phenyl]-3-phenylurea (PubChem CID 2805877) has the molecular formula C21H14N4O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-[4-(2,6-dicyanophenoxy)phenyl]-3-phenylurea.
| Compound Name | 1-[4-(2,6-dicyanophenoxy)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 2805877 |
| Molecular Formula | C21H14N4O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-[4-(2,6-dicyanophenoxy)phenyl]-3-phenylurea |
| SMILES | N#Cc1cccc(C#N)c1Oc1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H14N4O2/c22-13-15-5-4-6-16(14-23)20(15)27-19-11-9-18(10-12-19)25-21(26)24-17-7-2-1-3-8-17/h1-12H,(H2,24,25,26) |
| InChIKey | FJMLXEAJWZRSEN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |