C16H21N3O2 — CID 59016617
N'-[(E)-1-cyano-3,3-dimethylbut-1-en-2-yl]-3-methoxy-2-methylbenzohydrazide (PubChem CID 59016617) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N'-[(E)-1-cyano-3,3-dimethylbut-1-en-2-yl]-3-methoxy-2-methylbenzohydrazide.
| Compound Name | N'-[(E)-1-cyano-3,3-dimethylbut-1-en-2-yl]-3-methoxy-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 59016617 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N'-[(E)-1-cyano-3,3-dimethylbut-1-en-2-yl]-3-methoxy-2-methylbenzohydrazide |
| SMILES | COc1cccc(C(=O)NN/C(=C/C#N)C(C)(C)C)c1C |
| InChI | InChI=1S/C16H21N3O2/c1-11-12(7-6-8-13(11)21-5)15(20)19-18-14(9-10-17)16(2,3)4/h6-9,18H,1-5H3,(H,19,20)/b14-9+ |
| InChIKey | SCGHCXXIJXDYRU-NTEUORMPSA-N |
| XLogP | 2.69 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|