C21H32N2O2 — CID 59016603
3-methoxy-2-methyl-N-[[(E)-2,2,5,6,6-pentamethylhept-4-en-3-ylidene]amino]benzamide (PubChem CID 59016603) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 3-methoxy-2-methyl-N-[[(E)-2,2,5,6,6-pentamethylhept-4-en-3-ylidene]amino]benzamide.
| Compound Name | 3-methoxy-2-methyl-N-[[(E)-2,2,5,6,6-pentamethylhept-4-en-3-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 59016603 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 3-methoxy-2-methyl-N-[[(E)-2,2,5,6,6-pentamethylhept-4-en-3-ylidene]amino]benzamide |
| SMILES | COc1cccc(C(=O)NN=C(/C=C(\C)C(C)(C)C)C(C)(C)C)c1C |
| InChI | InChI=1S/C21H32N2O2/c1-14(20(3,4)5)13-18(21(6,7)8)22-23-19(24)16-11-10-12-17(25-9)15(16)2/h10-13H,1-9H3,(H,23,24)/b14-13+,22-18? |
| InChIKey | WTNGPRHFTRPASB-QUILAZDKSA-N |
| XLogP | 5.13 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|