C11H15N5 — CID 43162352
2-(piperazin-1-ylmethyl)imidazo[1,2-a]pyrimidine (PubChem CID 43162352) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 2-(piperazin-1-ylmethyl)imidazo[1,2-a]pyrimidine.
| Compound Name | 2-(piperazin-1-ylmethyl)imidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 43162352 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-(piperazin-1-ylmethyl)imidazo[1,2-a]pyrimidine |
| SMILES | c1cnc2nc(CN3CCNCC3)cn2c1 |
| InChI | InChI=1S/C11H15N5/c1-2-13-11-14-10(9-16(11)5-1)8-15-6-3-12-4-7-15/h1-2,5,9,12H,3-4,6-8H2 |
| InChIKey | JPRFVGSGNNVXPR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |