C13H13ClN2O — CID 43164952
2-[chloro(phenyl)methyl]-5-(2-methylcyclopropyl)-1,3,4-oxadiazole (PubChem CID 43164952) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is 2-[chloro(phenyl)methyl]-5-(2-methylcyclopropyl)-1,3,4-oxadiazole.
| Compound Name | 2-[chloro(phenyl)methyl]-5-(2-methylcyclopropyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 43164952 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-[chloro(phenyl)methyl]-5-(2-methylcyclopropyl)-1,3,4-oxadiazole |
| SMILES | CC1CC1c1nnc(C(Cl)c2ccccc2)o1 |
| InChI | InChI=1S/C13H13ClN2O/c1-8-7-10(8)12-15-16-13(17-12)11(14)9-5-3-2-4-6-9/h2-6,8,10-11H,7H2,1H3 |
| InChIKey | OFDVLOVIFQWPPF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|