C12H17N3O4 — CID 43170021
6-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]hexanoic acid (PubChem CID 43170021) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 6-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 43170021 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 6-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)Cn1cccnc1=O |
| InChI | InChI=1S/C12H17N3O4/c16-10(9-15-8-4-7-14-12(15)19)13-6-3-1-2-5-11(17)18/h4,7-8H,1-3,5-6,9H2,(H,13,16)(H,17,18) |
| InChIKey | WABLMQXPNCQQTC-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|