C11H19N3O6S — CID 43171434
4-amino-2-[(1-methylsulfonylpiperidine-3-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 43171434) has the molecular formula C11H19N3O6S and a molecular weight of 321.36 g/mol. Its IUPAC name is 4-amino-2-[(1-methylsulfonylpiperidine-3-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(1-methylsulfonylpiperidine-3-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43171434 |
| Molecular Formula | C11H19N3O6S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-amino-2-[(1-methylsulfonylpiperidine-3-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)NC(CC(N)=O)C(=O)O)C1 |
| InChI | InChI=1S/C11H19N3O6S/c1-21(19,20)14-4-2-3-7(6-14)10(16)13-8(11(17)18)5-9(12)15/h7-8H,2-6H2,1H3,(H2,12,15)(H,13,16)(H,17,18) |
| InChIKey | SULQADUCFAIWAM-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |