C13H22N2O5S — CID 95783962
methyl (2S)-2-cyclopropyl-2-[[(3S)-1-methylsulfonylpiperidine-3-carbonyl]amino]acetate (PubChem CID 95783962) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is methyl (2S)-2-cyclopropyl-2-[[(3S)-1-methylsulfonylpiperidine-3-carbonyl]amino]acetate.
| Compound Name | methyl (2S)-2-cyclopropyl-2-[[(3S)-1-methylsulfonylpiperidine-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 95783962 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | methyl (2S)-2-cyclopropyl-2-[[(3S)-1-methylsulfonylpiperidine-3-carbonyl]amino]acetate |
| SMILES | COC(=O)[C@@H](NC(=O)[C@H]1CCCN(S(C)(=O)=O)C1)C1CC1 |
| InChI | InChI=1S/C13H22N2O5S/c1-20-13(17)11(9-5-6-9)14-12(16)10-4-3-7-15(8-10)21(2,18)19/h9-11H,3-8H2,1-2H3,(H,14,16)/t10-,11-/m0/s1 |
| InChIKey | FUBCWWJEVDEDPW-QWRGUYRKSA-N |
| XLogP | -0.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |