C13H19N3O5 — CID 43172044
7-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]heptanoic acid (PubChem CID 43172044) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 7-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]heptanoic acid.
| Compound Name | 7-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 43172044 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 7-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C13H19N3O5/c17-10-6-7-12(19)16(15-10)9-11(18)14-8-4-2-1-3-5-13(20)21/h6-7H,1-5,8-9H2,(H,14,18)(H,15,17)(H,20,21) |
| InChIKey | XCGSNQKCGPPZNB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|