C13H17N3O5 — CID 64560125
1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]azepane-2-carboxylic acid (PubChem CID 64560125) has the molecular formula C13H17N3O5 and a molecular weight of 295.29 g/mol. Its IUPAC name is 1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]azepane-2-carboxylic acid.
| Compound Name | 1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]azepane-2-carboxylic acid |
|---|---|
| PubChem CID | 64560125 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]azepane-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCCN1C(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C13H17N3O5/c17-10-5-6-11(18)16(14-10)8-12(19)15-7-3-1-2-4-9(15)13(20)21/h5-6,9H,1-4,7-8H2,(H,14,17)(H,20,21) |
| InChIKey | CXMOJLGNLUNBKO-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |