C17H27N3S — CID 43175015
3-[4-(2,3-dimethylphenyl)piperazin-1-yl]pentanethioamide (PubChem CID 43175015) has the molecular formula C17H27N3S and a molecular weight of 305.49 g/mol. Its IUPAC name is 3-[4-(2,3-dimethylphenyl)piperazin-1-yl]pentanethioamide.
| Compound Name | 3-[4-(2,3-dimethylphenyl)piperazin-1-yl]pentanethioamide |
|---|---|
| PubChem CID | 43175015 |
| Molecular Formula | C17H27N3S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 3-[4-(2,3-dimethylphenyl)piperazin-1-yl]pentanethioamide |
| SMILES | CCC(CC(N)=S)N1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C17H27N3S/c1-4-15(12-17(18)21)19-8-10-20(11-9-19)16-7-5-6-13(2)14(16)3/h5-7,15H,4,8-12H2,1-3H3,(H2,18,21) |
| InChIKey | GPYGOXDOCVTEKK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|