About 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide
3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide (PubChem CID 43175067) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide.
Molecular Properties
| Compound Name | 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide |
| PubChem CID | 43175067 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide |
| SMILES | CCC(C/C(N)=N/O)N(CC)Cc1ccccc1 |
| InChI | InChI=1S/C14H23N3O/c1-3-13(10-14(15)16-18)17(4-2)11-12-8-6-5-7-9-12/h5-9,13,18H,3-4,10-11H2,1-2H3,(H2,15,16) |
| InChIKey | DAGGHJWNQKGGQI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide?
The IUPAC name of 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide (CID 43175067) is 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide.
What is the SMILES notation for 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide?
The canonical SMILES for 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide is CCC(C/C(N)=N/O)N(CC)Cc1ccccc1.
What is the InChIKey of 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide?
The InChIKey is DAGGHJWNQKGGQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O/c1-3-13(10-14(15)16-18)17(4-2)11-12-8-6-5-7-9-12/h5-9,13,18H,3-4,10-11H2,1-2H3,(H2,15,16).
What are the key properties of 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide?
3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide has a molecular weight of 249.36 g/mol, XLogP of 2.42, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[benzyl(ethyl)amino]-N'-hydroxypentanimidamide is sourced from PubChem (CID 43175067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).